| Catalog Number |
ACM1398065570 |
| CAS |
1398065-57-0 |
| Synonyms |
(Phenyl-D5)Methyl acetate |
| IUPAC Name |
(2,3,4,5,6-pentadeuteriophenyl)methyl acetate |
| Molecular Weight |
155.21 |
| Molecular Formula |
C9H5D5O2 |
| InChI |
InChI=1S/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3/i2D,3D,4D,5D,6D |
| InChI Key |
QUKGYYKBILRGFE-VIQYUKPQSA-N |
| Chemical Formula |
CH3COOCH2C6D5 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])COC(=O)C)[2H])[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
140-11-4 |
| Unlabeled Synonyms |
Acetic acid benzyl ester |
