| Catalog Number |
ACM2694782 |
| CAS |
2694-78-2 |
| Structure |
 |
| Synonyms |
Benzophenone--d5; 2,3,4,5,6-Pentadeuteriobenzophenon |
| IUPAC Name |
(2,3,4,5,6-pentadeuteriophenyl)-phenylmethanone |
| Molecular Weight |
187.25 |
| Molecular Formula |
C13H5D5O |
| InChI |
InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,3D,4D,7D,8D |
| InChI Key |
RWCCWEUUXYIKHB-DYVTXVBDSA-N |
| Boiling Point |
305 °C (lit.) |
| Melting Point |
47-51 °C (lit.) |
| Purity |
98 atom % D |
| Chemical Formula |
C6D5COC6H5 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=CC=CC=C2)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
119-61-9 |
| Unlabeled Synonyms |
Diphenylmethanone; Diphenyl ketone |
