| Catalog Number |
ACM17217844 |
| CAS |
17217-84-4 |
| Structure |
 |
| Synonyms |
Benzenecarboxylic Acid-18O2; Benzeneformic Acid-18O2; Benzenemethanoic Acid-18O2; Carboxybenzene-18O2; Dracylic Acid-18O2; E 210-18O2; HA 1-18O2; MENNO-Florades-18O2; NSC 149-18O2; Phenylcarboxylic Acid-18O2; Phenylformic Acid-18O2; Purox B-18O2; Retarder BA-18O2; Retardex-18O2; Salvo Liquid-18O2; Solvo Powder-18O2; Tenn-Plas-18O2; VevoVitall-18O2 |
| IUPAC Name |
benzoic-18O2 acid |
| Molecular Weight |
126.12 |
| Molecular Formula |
C7H618O2 |
| Canonical SMILES |
[18OH]C(C1=CC=CC=C1)=[18O] |
| InChI |
1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i8+2,9+2 |
| Purity |
0.98 |
| Storage |
Store at 2-8°C |
| Exact Mass |
126.045 |
| LogP |
1.3848 |
| MDL Number |
MFCD31563058 |
| PSA |
37.3 |
| Type |
Aromatic Compounds |
Please kindly note that our products and services are for research use only.
