| Catalog Number |
ACM125945984-2 |
| CAS |
125945-98-4 |
| Structure |
 |
| Description |
Benzoic acid-13C6 is the 13C-labeled Benzoic acid. Benzoic acid is an aromatic alcohol existing naturally in many plants and is a common additive to food, drinks, cosmetics and other products. It acts as preservatives through inhibiting both bacteria and fungi. |
| Molecular Weight |
128.08 |
| Molecular Formula |
C13C6H6O2 |
| Canonical SMILES |
OC([13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1)=O |
| Purity |
≥98.0% |
| Appearance |
Solid |
| Storage |
4℃, stored under nitrogen, away from moisture. In solvent : -80℃, 6 months; -20℃, 1 month (stored under nitrogen, away from moisture). |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
