| Catalog Number |
ACM3880997-1 |
| CAS |
3880-99-7 |
| Structure |
 |
| Description |
Benzoic acid-13C is the 13C-labeled Benzoic acid. Benzoic acid is an aromatic alcohol existing naturally in many plants and is a common additive to food, drinks, cosmetics and other products. It acts as preservatives through inhibiting both bacteria and fungi. |
| Synonyms |
Benzoic acid-alpha-13C |
| Molecular Weight |
123.11 |
| Molecular Formula |
C613CH6O2 |
| Canonical SMILES |
O[13C](C1=CC=CC=C1)=O |
| InChI |
InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i7+1 |
| InChI Key |
WPYMKLBDIGXBTP-CDYZYAPPSA-N |
| Boiling Point |
249 °C (lit.) |
| Melting Point |
121-125 °C (lit.) |
| Purity |
95% min |
| Storage |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Isomeric SMILES |
C1=CC=C(C=C1)[13C](=O)O |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Unlabeled CAS |
65-85-0 |
