Benzidine D8 500 µg/mL in Acetonitrile:Methanol
| Catalog Number |
ACM92890636-2 |
| CAS |
92890-63-6 |
| Structure |
 |
| Synonyms |
4,4'-Diamino(biphenyl-d8) |
| IUPAC Name |
4-(4-amino-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuterioaniline |
| Molecular Weight |
192.29 |
| Molecular Formula |
C12D8H4N2 |
| Canonical SMILES |
[2H]c1c([2H])c(c([2H])c([2H])c1N)c2c([2H])c([2H])c(N)c([2H])c2[2H] |
| InChI |
InChI=1S/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H2/i1D,2D,3D,4D,5D,6D,7D,8D |
| Accurate Mass |
192.1503 |
| Format |
Single Solution |
| SIL Type |
Deuterium |
| Unlabeled CAS |
92-87-5 |
Please kindly note that our products and services are for research use only.
