Bendamustine-d6 (major) Hydrochloride
| Catalog Number |
ACMA00065001 |
| Synonyms |
5-[Bis(2-chloroethyl)-amino]-1-methyl-1H-benzimidazole-2-butanoic Acid-d6 Hydrochloride, Cytostasan-d6, Ribomustin-d6, Treanda-d6 |
| Molecular Weight |
400.76 |
| Molecular Formula |
C16H16D6Cl3N3O2 |
| Canonical SMILES |
ClCCN(CCCl)C1=C([H][2H])C=C(N(C([2H])([2H])[2H])C(CCC([2H])([2H])C(O)=O)=N2)C2=C1[H][2H].Cl |
| Storage |
-20 °C |
| API Family |
Bendamustine Hydrochloride |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
3543-75-7 |
Please kindly note that our products and services are for research use only.
