Atrazine-desethyl D6 100 µg/mL in Acetone
| Catalog Number |
ACM2733387385 |
| CAS |
2733387-38-5 |
| Structure |
 |
| Synonyms |
Atrazine-desethyl D6 |
| IUPAC Name |
6-chloro-2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight |
193.67 |
| Molecular Formula |
C6D6H4ClN5 |
| Canonical SMILES |
[2H]C([2H])([2H])C(Nc1nc(N)nc(Cl)n1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C6H10ClN5/c1-3(2)9-6-11-4(7)10-5(8)12-6/h3H,1-2H3,(H3,8,9,10,11,12)/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
193.1001 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
