Atrazine 13C3 (triazine 13C3) 100 µg/mL in Acetone
| Catalog Number |
ACM1443685800-1 |
| CAS |
1443685-80-0 |
| Structure |
 |
| Synonyms |
Atrazine 13C3 (ring 13C3) |
| IUPAC Name |
6-chloro-2-N-ethyl-4-N-propan-2-yl-(2,4,6-^{13}C_{3})1,3,5-triazine-2,4-diamine |
| Molecular Weight |
218.66 |
| Molecular Formula |
13C3C5H14ClN5 |
| Canonical SMILES |
CCN[13c]1n[13c](Cl)n[13c](NC(C)C)n1 |
| InChI |
InChI=1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14)/i6+1,7+1,8+1 |
| Storage |
+20 °C |
| Accurate Mass |
218.1038 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Carbon |
Please kindly note that our products and services are for research use only.
