| Catalog Number |
ACM1356849176 |
| CAS |
1356849-17-6 |
| Structure |
 |
| Description |
Aspartame-d5 is the deuterium labeled Aspartame. Aspartame is an important sweetener that is widely used in pharmaceutical processing and food processing. |
| Synonyms |
L-α-Aspartyl-L-phenylalanine 2-(methyl-d5) ester |
| IUPAC Name |
(3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-yl]amino]-4-oxobutanoic acid |
| Molecular Weight |
299.33 |
| Molecular Formula |
C14H13D5N2O5 |
| Canonical SMILES |
[2H]C1=C([2H])C([2H])=C([2H])C([2H])=C1C[C@@H](C(OC)=O)NC([C@@H](N)CC(O)=O)=O |
| InChI |
InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1/i2D,3D,4D,5D,6D |
| InChI Key |
IAOZJIPTCAWIRG-HEPISUNPSA-N |
| Melting Point |
197-231 °C |
| Appearance |
White solid |
| Storage |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Format |
Neat |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)OC)NC(=O)[C@H](CC(=O)O)N)[2H])[2H] |
| Shipping |
Room temperature in continental US; may vary elsewhere. |
| Shipping Temperature |
Room temperature |
| Storage Conditions |
2-8 °C Fridge/Coldroom |
| Unlabeled CAS |
22839-47-0 |
