| Catalog Number |
ACM65387237-1 |
| CAS |
65387-23-7 |
| Structure |
 |
| Synonyms |
Ammonium-D4 formate-D |
| IUPAC Name |
deuterioformate;tetradeuterioazanium |
| Molecular Weight |
68.09 |
| Molecular Formula |
CD5NO2 |
| InChI |
InChI=1S/CH2O2.H3N/c2-1-3;/h1H,(H,2,3);1H3/i1D;/hD4 |
| InChI Key |
VZTDIZULWFCMLS-AQOVZKNZSA-N |
| Chemical Formula |
DCOOND4 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C(=O)[O-].[2H][N+]([2H])([2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
540-69-2 |
| Unlabeled Synonyms |
Formic acid, ammonium salt |
