| Catalog Number |
ACM194787058-1 |
| CAS |
194787-05-8 |
| Structure |
 |
| Synonyms |
Ammonium-D4 acetate-D3 |
| Molecular Weight |
84.13 |
| Molecular Formula |
C2D7NO2 |
| InChI |
InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3/i1D3;/hD4 |
| InChI Key |
USFZMSVCRYTOJT-KYWLLVRESA-N |
| Melting Point |
110-112 °C (dec.) (lit.) |
| Appearance |
White crystalline powder |
| Chemical Formula |
CD3COOND4 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)O[2H].[2H]N([2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
631-61-8 |
