Amitraz D12 100 µg/mL in Acetone
| Catalog Number |
ACM2460730189 |
| CAS |
2460730-18-9 |
| Structure |
 |
| Synonyms |
Amitraz D12 (methylphenyl D12), Amitraz D12, Amitraz D12 (di(dimethylphenyl D6)), Amitraz D12 (2,2',4,4'-tetramethyl D3) |
| IUPAC Name |
N-[(E)-[2,4-bis(trideuteriomethyl)phenyl]iminomethyl]-N-methyl-2,4-bis(trideuteriomethyl)benzenecarboximidamide |
| Molecular Weight |
305.48 |
| Molecular Formula |
C19D1D11N3 |
| Canonical SMILES |
[2H]C([2H])([2H])c1ccc(\N=C\N(C)C(=N)c2ccc(cc2C([2H])([2H])[2H])C([2H])([2H])[2H])c(c1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C19H23N3/c1-13-6-8-17(15(3)10-13)19(20)22(5)12-21-18-9-7-14(2)11-16(18)4/h6-12,20H,1-5H3/b20-19?,21-12+/i1D3,2D3,3D3,4D3 |
| Storage |
+20 °C |
| Accurate Mass |
305.2645 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
33089-61-1 |
Please kindly note that our products and services are for research use only.
