Aminopyrine (N,N-Dimethyl-13C2)
| Catalog Number |
ACM60433901-1 |
| CAS |
60433-90-1 |
| Structure |
 |
| Synonyms |
Aminopyrine-[N,N-dimethyl-13C2] |
| IUPAC Name |
4-[di((1-13C)methyl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| Molecular Weight |
233.28 |
| Molecular Formula |
13C2C11H17N3O |
| InChI |
InChI=1S/C13H17N3O/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11/h5-9H,1-4H3/i2+1,3+1 |
| InChI Key |
RMMXTBMQSGEXHJ-SUEIGJEOSA-N |
| Melting Point |
107-109 °C (225-228 °F) (lit.) |
| Purity |
98% |
| Appearance |
Solid |
| Isomeric SMILES |
CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N([13CH3])[13CH3] |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Six months after receipt. Re-QC after six months. |
| Unlabeled CAS |
58-15-1 |
| Unlabeled Synonyms |
4-Dimethylaminoantipyrine |
Please kindly note that our products and services are for research use only.
