1-Aminohydantoin 13C3 (2,4,5 13C3) 100 µg/mL in Acetonitrile
| Catalog Number |
ACM957509318-2 |
| CAS |
957509-31-8 |
| Structure |
 |
| IUPAC Name |
1-amino-(2,4,5-^{13}C_{3})1,3-diazolidine-2,4-dione |
| Molecular Weight |
118.07 |
| Molecular Formula |
13C3H5N3O2 |
| Canonical SMILES |
NN1[13CH2][13C](=O)N[13C]1=O |
| InChI |
InChI=1S/C3H5N3O2/c4-6-1-2(7)5-3(6)8/h1,4H2,(H,5,7,8)/i1+1,2+1,3+1 |
| Storage |
+20 °C |
| Accurate Mass |
118.0482 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Carbon |
Please kindly note that our products and services are for research use only.
