| Catalog Number |
ACM344298960-1 |
| CAS |
344298-96-0 |
| Structure |
 |
| Synonyms |
4-Aminodiphenyl; 4-Biphenylamine; 4-Phenylaniline |
| IUPAC Name |
2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| Molecular Weight |
178.28 |
| Molecular Formula |
C6D5C6D4NH2 |
| InChI |
InChI=1S/C12H11N/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,13H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| InChI Key |
DMVOXQPQNTYEKQ-LOIXRAQWSA-N |
| Accurate Mass |
178.1456 |
| Format |
Neat |
| Functional Group |
Amines & Amine Salts |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])N)[2H])[2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.05 g
In Stock
0.1 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
92-67-1 |
