2-Aminobiphenyl-d9 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM344298971-2 |
| CAS |
344298-97-1 |
| Structure |
 |
| Synonyms |
2-Aminobiphenyl-d9 |
| IUPAC Name |
[1,1'-biphenyl]-d9-2-amine |
| Molecular Weight |
178.28 |
| Molecular Formula |
C12H2D9N |
| Canonical SMILES |
NC1=C([2H])C([2H])=C([2H])C([2H])=C1C2=C([2H])C([2H])=C([2H])C([2H])=C2[2H] |
| InChI |
InChI=1S/C12H11N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,13H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D |
| Accurate Mass |
178.15 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
90-41-5 |
Please kindly note that our products and services are for research use only.
