| Catalog Number |
ACM350820018 |
| CAS |
350820-01-8 |
| Structure |
 |
| Synonyms |
p-Aminobenzoic Acid; PABA; Vitamin Bx |
| IUPAC Name |
4-amino-2,3,5,6-tetradeuteriobenzoic acid |
| Molecular Weight |
141.16 |
| Molecular Formula |
H2NC6D4COOH |
| Canonical SMILES |
C1=CC(=CC=C1C(=O)O)N |
| InChI |
InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10)/i1D,2D,3D,4D |
| InChI Key |
ALYNCZNDIQEVRV-RHQRLBAQSA-N |
| Melting Point |
179-180 °C |
| Purity |
98 atom % D |
| Exact Mass |
141.07300 |
| Functional Group |
Amines & Amine Salts,Carboxylic Acids & Salts |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])N)[2H] |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.1 g
In Stock
0.25 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
150-13-0 |
