Alpha-Ketoisovaleric acid, sodium salt (Dimethyl-13C2)
| Catalog Number |
ACM634908422 |
| CAS |
634908-42-2 |
| Structure |
 |
| Synonyms |
2-Keto-3-(methyl-13C)-butyric acid-4-13C sodium salt |
| IUPAC Name |
sodium;3-(1-13C)methyl-2-oxo(4-13C)butanoate |
| Molecular Weight |
140.08 |
| Molecular Formula |
13C2C3H7NaO3 |
| Canonical SMILES |
[13CH3]C([13CH3])C(=O)C(=O)[O-].[Na+] |
| InChI |
InChI=1S/C5H8O3.Na/c1-3(2)4(6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1/i1+1,2+1; |
| InChI Key |
WIQBZDCJCRFGKA-AWQJXPNKSA-M |
| Melting Point |
220-230 °C (428-446 °F) (dec.) |
| Purity |
98% |
| Appearance |
White solid |
| Chemical Formula |
(*CH3)2CHCOCOONa |
| Isomeric SMILES |
[13CH3]C([13CH3])C(=O)C(=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
One year after receipt. Re-QC after one year. |
| Unlabeled CAS |
3715-29-5 |
| Unlabeled Synonyms |
3-Methyl-2-oxobutyric acid sodium salt; 3-Methyl-2-oxobutanoic acid sodium salt; α-Ketoisovaleric acid sodium salt |
Please kindly note that our products and services are for research use only.
