Alpha-ketoisovaleric acid, sodium salt (3-Methyl-13C; 3,4,4,4-d4)
| Catalog Number |
ACM1202865404 |
| CAS |
1202865-40-4 |
| Synonyms |
α-Ketoisovaleric acid sodium salt 3-methyl-13C, D4 |
| IUPAC Name |
sodium;3-methyl-2-oxo(4-13C)butanoate |
| Molecular Weight |
143.11 |
| Molecular Formula |
13CC4H3D4NaO3 |
| Canonical SMILES |
CC([13CH3])C(=O)C(=O)[O-].[Na+] |
| InChI |
InChI=1S/C5H8O3.Na/c1-3(2)4(6)5(7)8;/h3H,1-2H3,(H,7,8);/q;+1/p-1/i1+1; |
| InChI Key |
WIQBZDCJCRFGKA-YTBWXGASSA-M |
| Melting Point |
220-230 °C (428-446 °F) (dec.) |
| Purity |
98% |
| Appearance |
White solid |
| Chemical Formula |
*CH3CD(CD3)COCOONa |
| Isomeric SMILES |
CC([13CH3])C(=O)C(=O)[O-].[Na+] |
| Isotopic Enrichment |
98 atom % 13C; 98 atom % D |
| Stability |
One year after receipt. Re-QC after one year. |
| Unlabeled CAS |
3715-29-5 |
| Unlabeled Synonyms |
3-Methyl-2-oxobutyric acid sodium salt; 3-Methyl-2-oxobutanoic acid sodium salt; α-Ketoisovaleric acid sodium salt |
Please kindly note that our products and services are for research use only.
