| Catalog Number |
ACM116173672-1 |
| CAS |
116173-67-2 |
| Structure |
 |
| Synonyms |
Beta-Alanine-2,2,3,3-D4 |
| IUPAC Name |
3-amino-2,2,3,3-tetradeuteriopropanoic acid |
| Molecular Weight |
93.12 |
| Molecular Formula |
C3H3D4NO2 |
| Canonical SMILES |
[2H]C([2H])(C(=O)O)C([2H])([2H])N |
| InChI |
InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/i1D2,2D2 |
| InChI Key |
UCMIRNVEIXFBKS-LNLMKGTHSA-N |
| Melting Point |
198.5-199 °C (decomp) |
| Appearance |
White solid |
| Chemical Formula |
H2NCD2CD2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O)C([2H])([2H])N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
107-95-9 |
| Unlabeled Synonyms |
3-Aminopropionic acid; H-β-Ala-OH |
