Alachlor D3 (methoxy D3) 100 µg/mL in Acetone
| Catalog Number |
ACM2733718391 |
| CAS |
2733718-39-1 |
| Structure |
 |
| IUPAC Name |
2-chloro-N-(2,6-diethylphenyl)-N-(trideuteriomethoxymethyl)acetamide |
| Molecular Weight |
272.79 |
| Molecular Formula |
C14D3H17ClNO2 |
| Canonical SMILES |
[2H]C([2H])([2H])OCN(C(=O)CCl)c1c(CC)cccc1CC |
| InChI |
InChI=1S/C14H20ClNO2/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3/i3D3 |
| Storage |
+20 °C |
| Accurate Mass |
272.1371 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
