Alachlor D13 (2,6-diethylphenyl D13) 100 µg/mL in Acetone
| Catalog Number |
ACM1015856639-1 |
| CAS |
1015856-63-9 |
| Structure |
 |
| IUPAC Name |
2-chloro-N-(methoxymethyl)-N-[3,4,5-trideuterio-2,6-bis(1,1,2,2,2-pentadeuterioethyl)phenyl]acetamide |
| Molecular Weight |
282.85 |
| Molecular Formula |
C14D13H7ClNO2 |
| Canonical SMILES |
[2H]c1c([2H])c(c(N(COC)C(=O)CCl)c(c1[2H])C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C14H20ClNO2/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3/i1D3,2D3,4D2,5D2,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
282.1999 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
15972-60-8 |
Please kindly note that our products and services are for research use only.
