Adipic acid, bis-2-ethylhexyl ester D4 100 µg/mL in Acetone
| Catalog Number |
ACM2714485477 |
| CAS |
2714485-47-7 |
| Structure |
 |
| Synonyms |
bis(2-ethylhexyl) 3,3,4,4-tetradeuteriohexanedioate |
| IUPAC Name |
bis(2-ethylhexyl) 3,3,4,4-tetradeuteriohexanedioate |
| Molecular Weight |
374.59 |
| Molecular Formula |
C22D4H38O4 |
| Canonical SMILES |
[2H]C([2H])(CC(=O)OCC(CC)CCCC)C([2H])([2H])CC(=O)OCC(CC)CCCC |
| InChI |
InChI=1S/C22H42O4/c1-5-9-13-19(7-3)17-25-21(23)15-11-12-16-22(24)26-18-20(8-4)14-10-6-2/h19-20H,5-18H2,1-4H3/i11D2,12D2 |
| Storage |
+20 °C |
| Accurate Mass |
374.3334 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
