| Catalog Number |
ACM109923526 |
| CAS |
109923-52-6 |
| Structure |
 |
| Synonyms |
6-Aminopurine; Vitamin B 4 |
| IUPAC Name |
2-deuterio-3,7-dihydropurin-6-imine |
| Molecular Weight |
135.15 |
| Molecular Formula |
C5H4DN5 |
| InChI |
InChI=1S/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)/i2D |
| InChI Key |
GFFGJBXGBJISGV-VMNATFBRSA-N |
| Melting Point |
>300 °C |
| Purity |
97 atom % D |
| Functional Group |
Amines & Amine Salts,Heterocycles |
| Isomeric SMILES |
[2H]C1=NC(=N)C2=C(N1)N=CN2 |
| Isotopic Enrichment |
97 atom % D |
| Packaging |
0.05 g
In Stock
0.1 g
In Stock |
| Shipping Hazards |
TOXIC (PGIII) |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
73-24-5 |
| Unlabeled Synonyms |
6-Aminopurine; Vitamin B4 |
