Acetylcholine-d9 Chloride
| Catalog Number |
ACM344298959-1 |
| CAS |
344298-95-9 |
| Structure |
 |
| Synonyms |
Ethanaminium, 2-(acetyloxy)-N,N,N-tri(methyl-d3)-, chloride (9CI), Acetylcholine-d9 Chloride, Acetylcholine-D9 Chloride (N,N,N-trimethyl D9) |
| IUPAC Name |
2-acetyloxyethyl-tris(trideuteriomethyl)azanium;chloride |
| Molecular Weight |
190.72 |
| Molecular Formula |
C7D9H7NO2·Cl |
| Canonical SMILES |
[Cl-].[2H]C([2H])([2H])[N+](CCOC(=O)C)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C7H16NO2.ClH/c1-7(9)10-6-5-8(2,3)4;/h5-6H2,1-4H3;1H/q+1;/p-1/i2D3,3D3,4D3; |
| Storage |
+4 °C |
| Accurate Mass |
190.1434 |
| API Family |
Acetylcholine Chloride |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
60-31-1 |
Please kindly note that our products and services are for research use only.
