Acetochlor D11 100 µg/mL in Acetone
| Catalog Number |
ACM1189897446-2 |
| CAS |
1189897-44-6 |
| Structure |
 |
| IUPAC Name |
2-chloro-N-(ethoxymethyl)-N-[3,4,5-trideuterio-2-(1,1,2,2,2-pentadeuterioethyl)-6-(trideuteriomethyl)phenyl]acetamide |
| Molecular Weight |
280.83 |
| Molecular Formula |
C14D11H9ClNO2 |
| Canonical SMILES |
[2H]c1c([2H])c(c(N(COCC)C(=O)CCl)c(c1[2H])C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C14H20ClNO2/c1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3/i1D3,3D3,4D2,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
280.1873 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
34256-82-1 |
Please kindly note that our products and services are for research use only.
