| Catalog Number |
ACM1186523-1 |
| CAS |
1186-52-3 |
| Structure |
 |
| Synonyms |
Acetic-D3 acid-D |
| IUPAC Name |
deuterio 2,2,2-trideuterioacetate |
| Molecular Weight |
64.08 |
| Molecular Formula |
C2D4O2 |
| InChI |
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| InChI Key |
QTBSBXVTEAMEQO-GUEYOVJQSA-N |
| Boiling Point |
115.5 °C (lit.) |
| Melting Point |
15-16 °C (lit.) |
| Flash Point |
104 °F |
| Purity |
99% |
| Density |
1.119 g/mL at 25 °C (lit.) |
| Appearance |
Colorless liquid |
| Chemical Formula |
CD3COOD |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)O[2H] |
| Isotopic Enrichment |
99 atom % D |
| pH |
2.5 (50g/L, H2O, 25 °C) |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
64-19-7 |
| Unlabeled Synonyms |
Glacial acetic acid |
