6-Methyl-d3-mercaptopurine
| Catalog Number |
ACM33312935 |
| CAS |
33312-93-5 |
| Structure |
 |
| Synonyms |
6-Methylmercaptopurine-d3; 6-(Methylthio)-9H-purine-d3 |
| IUPAC Name |
6-(trideuteriomethylsulfanyl)-7H-purine |
| Molecular Weight |
169.22 |
| Molecular Formula |
C6H3D3N4S |
| Canonical SMILES |
CSC1=NC=NC2=C1NC=N2 |
| InChI |
InChI=1S/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-3H,1H3,(H,7,8,9,10)/i1D3 |
| InChI Key |
UIJIQXGRFSPYQW-FIBGUPNXSA-N |
| Melting Point |
218-220 °C |
| Purity |
99 atom % D |
| Appearance |
White solid |
| Exact Mass |
169.05000 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])SC1=NC=NC2=C1NC=N2 |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| Unlabeled CAS |
50-66-8 |
| Unlabeled Synonyms |
6-(Methylthio)purine |
Please kindly note that our products and services are for research use only.
