| Catalog Number |
ACM96737938 |
| CAS |
96737-93-8 |
| Structure |
 |
| Synonyms |
5-Pregnan-3a-ol-20-one-d4 |
| IUPAC Name |
2,2,2-trideuterio-1-[(3R,5R,8R,9S,10S,13S,14S,17S)-17-deuterio-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| Molecular Weight |
322.52 |
| Molecular Formula |
C21H30D4O2 |
| InChI |
InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21-/m1/s1/i1D3,17D |
| InChI Key |
AURFZBICLPNKBZ-KWXKYAJASA-N |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C)C(=O)C([2H])([2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
128-20-1 |
| Unlabeled Synonyms |
Pregnanolone |
