| Catalog Number |
ACM252976117-1 |
| CAS |
252976-11-7 |
| Structure |
 |
| Synonyms |
5alpha-Pregnan-11beta,17alpha,21-triol-3,20-dione-1,2,4,5-D4 |
| IUPAC Name |
(5S,8S,9S,10S,11S,13S,14S,17R)-1,2,4,5-tetradeuterio-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| Molecular Weight |
368.51 |
| Molecular Formula |
C21H28D4O5 |
| InChI |
InChI=1S/C21H32O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h12,14-16,18,22,24,26H,3-11H2,1-2H3/t12-,14-,15-,16-,18+,19-,20-,21-/m0/s1/i5D,7D,9D,12D/t5?,7?,9?,12-,14-,15-,16-,18+,19-,20-,21- |
| InChI Key |
ACSFOIGNUQUIGE-ARCBVMEUSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1C([C@@]2([C@@H]3[C@@H](CC[C@]2(C(C1=O)[2H])[2H])[C@@H]4CC[C@@]([C@]4(C[C@@H]3O)C)(C(=O)CO)O)C)[2H] |
| Isotopic Enrichment |
94 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
516-41-6 |
| Unlabeled Synonyms |
5α-Dihydrocortisol; Allodihydrocortisol; 11β,17α,21-Trihydroxy-5α-pregnane-3,20-dione |
