| Catalog Number |
ACM358731187-1 |
| CAS |
358731-18-7 |
| Structure |
 |
| Synonyms |
5a-Cholestane-[2,2,3,3,4,4-D6] |
| IUPAC Name |
(8R,9S,10S,13R,14S,17R)-2,2,3,3,4,4-hexadeuterio-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| Molecular Weight |
378.71 |
| Molecular Formula |
C27H42D6 |
| InChI |
InChI=1S/C27H48/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h19-25H,6-18H2,1-5H3/t20-,21?,22+,23-,24+,25+,26+,27-/m1/s1/i6D2,7D2,11D2 |
| InChI Key |
XIIAYQZJNBULGD-PTHKICKKSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CCC2C(C1([2H])[2H])([2H])[2H])CC[C@@H]4[C@H](C)CCCC(C)C)C)C)[2H] |
| Isotopic Enrichment |
95 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
481-21-0 |
