| Catalog Number |
ACM1182005259-1 |
| CAS |
1182005-25-9 |
| Structure |
 |
| Synonyms |
Lathosterol-1,2,5alpha,6alpha-D4 |
| IUPAC Name |
(5S,6S,9R,10S,13R,14R,17R)-1,2,5,6-tetradeuterio-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| Molecular Weight |
390.68 |
| Molecular Formula |
C27H42D4O |
| InChI |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h10,18-21,23-25,28H,6-9,11-17H2,1-5H3/t19-,20+,21?,23-,24+,25+,26+,27-/m1/s1/i9D,13D,15D,20D/t9-,13?,15?,19+,20-,21?,23+,24-,25-,26-,27+/m0 |
| InChI Key |
IZVFFXVYBHFIHY-PYLADBSRSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[H][C@@]1(C=C2[C@@H]3CC[C@@H]([C@]3(CC[C@@H]2[C@@]4([C@@]1(CC(C(C4[2H])[2H])O)[2H])C)C)[C@H](C)CCCC(C)C)[2H] |
| Isotopic Enrichment |
96 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store frozen |
| Unlabeled CAS |
80-99-9 |
| Unlabeled Synonyms |
Lathosterol |
