Catalog Number |
ACM334473426 |
CAS |
334473-42-6 |
Synonyms |
5,6-Dihydrothymine-D6 |
IUPAC Name |
5,6,6-trideuterio-5-(trideuteriomethyl)-1,3-diazinane-2,4-dione |
Molecular Weight |
134.17 |
Molecular Formula |
C5H2D6N2O2 |
InChI |
InChI=1S/C5H8N2O2/c1-3-2-6-5(9)7-4(3)8/h3H,2H2,1H3,(H2,6,7,8,9)/i1D3,2D2,3D |
InChI Key |
NBAKTGXDIBVZOO-LIDOUZCJSA-N |
Appearance |
White solid |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1(C(C(=O)NC(=O)N1)([2H])C([2H])([2H])[2H])[2H] |
Isotopic Enrichment |
99 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
Unlabeled CAS |
696-04-8 |
Unlabeled Synonyms |
5,6-Dihydro-5-methyluracil; 5,6-Dihydro-5-methyl-2,4-dioxypyrimidine |