Catalog Number |
ACM55487633-1 |
CAS |
55487-63-3 |
Structure |
 |
Synonyms |
Deoxy corticosterone-d8; 11-Deoxy corticosterone-d8 |
IUPAC Name |
(8S,9S,10R,13S,14S,17S)-2,2,4,6,6,17-hexadeuterio-17-(2,2-dideuterio-2-hydroxyacetyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
Molecular Weight |
338.52 |
Molecular Formula |
C21H22D8O3 |
InChI |
InChI=1S/C21H30O3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h11,15-18,22H,3-10,12H2,1-2H3/t15-,16-,17-,18+,20-,21-/m0/s1/i3D2,7D2,11D,12D2,18D |
InChI Key |
ZESRJSPZRDMNHY-JRMIWGODSA-N |
Melting Point |
132-134 °C |
Purity |
97% |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=C2[C@](CC(C1=O)([2H])[2H])([C@H]3CC[C@]4([C@H]([C@@H]3CC2([2H])[2H])CC[C@]4([2H])C(=O)C([2H])([2H])O)C)C |
Isotopic Enrichment |
96 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
64-85-7 |
Synonyms (Unlabeled) |
11-Deoxycorticosterone; 21-Hydroxyprogesterone; Desoxycortone; 21-Hydroxy-4-pregnene-3,20-dione; Cortexone |