| Catalog Number |
ACM1271728074 |
| CAS |
1271728-07-4 |
| Synonyms |
11,21-Dihydroxyprogesterone-d8; 17-Deoxycortisol-d8 |
| IUPAC Name |
(8S,9S,10R,11S,13S,14S,17S)-2,2,4,6,6,17-hexadeuterio-17-(2,2-dideuterio-2-hydroxyacetyl)-11-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| Molecular Weight |
354.51 |
| Molecular Formula |
C21H22D8O4 |
| InChI |
InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1/i3D2,7D2,9D,11D2,16D |
| InChI Key |
OMFXVFTZEKFJBZ-VWODBOJYSA-N |
| Appearance |
Pale yellow solid |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C2[C@](CC(C1=O)([2H])[2H])([C@H]3[C@H](C[C@]4([C@H]([C@@H]3CC2([2H])[2H])CC[C@]4([2H])C(=O)C([2H])([2H])O)C)O)C |
| Isotopic Enrichment |
97 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
50-22-6 |
| Unlabeled Synonyms |
Corticosterone; 17-Deoxycortisol; 11β,21-Dihydroxyprogesterone |
