| Catalog Number |
ACM344298982 |
| CAS |
344298-98-2 |
| Structure |
 |
| Synonyms |
4-Methylvaleric acid-[D11] |
| IUPAC Name |
2,2,3,3,4,5,5,5-octadeuterio-4-(trideuteriomethyl)pentanoic acid |
| Molecular Weight |
127.23 |
| Molecular Formula |
C6HD11O2 |
| Canonical SMILES |
CC(C)CCC(=O)O |
| InChI |
InChI=1S/C6H12O2/c1-5(2)3-4-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)/i1D3,2D3,3D2,4D2,5D |
| InChI Key |
FGKJLKRYENPLQH-KUXNVAAFSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
(CD3)2CDCD2CD2COOH |
| Exact Mass |
127.15300 |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
646-07-1 |
| Unlabeled Synonyms |
4-Methylvaleric acid; Isocaproic acid |
