| Catalog Number |
ACM358730833 |
| CAS |
358730-83-3 |
| Structure |
 |
| Synonyms |
1-(4-(Methyl-D3)phenyl-2,3,5,6-D4)ethan-1-one-2,2,2-D3 |
| IUPAC Name |
2,2,2-trideuterio-1-[2,3,5,6-tetradeuterio-4-(trideuteriomethyl)phenyl]ethanone |
| Molecular Weight |
144.24 |
| Molecular Formula |
C9D10O |
| InChI |
InChI=1S/C9H10O/c1-7-3-5-9(6-4-7)8(2)10/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChI Key |
GNKZMNRKLCTJAY-ZGYYUIRESA-N |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(=O)C([2H])([2H])[2H])[2H])[2H])C([2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
122-00-9 |
| Unlabeled Synonyms |
p-Acetyltoluene; Methyl-p-tolyl ketone |
