| Catalog Number |
ACM1219803083-1 |
| CAS |
1219803-08-3 |
| IUPAC Name |
deuterio 2,3,5,6-tetradeuterio-4-(dideuteriomethoxy)benzoate |
| Molecular Weight |
159.19 |
| Molecular Formula |
C8HD7O3 |
| InChI |
InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/i1D2,2D,3D,4D,5D/hD |
| InChI Key |
ZEYHEAKUIGZSGI-NSYKEGMCSA-N |
| Chemical Formula |
CD3OC6D4COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(=O)O[2H])[2H])[2H])OC([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
100-09-4 |
| Unlabeled Synonyms |
p-Methoxybenzoic acid; p-Anisic acid |
