4-Methoxy-d3-benzaldehyde
| Catalog Number |
ACM342611045 |
| CAS |
342611-04-5 |
| Structure |
 |
| Synonyms |
4-((2)H3)Methoxybenzaldehyde |
| IUPAC Name |
4-(trideuteriomethoxy)benzaldehyde |
| Molecular Weight |
139.17 |
| Molecular Formula |
C8H5D3O2 |
| Canonical SMILES |
COC1=CC=C(C=C1)C=O |
| InChI |
InChI=1S/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3/i1D3 |
| InChI Key |
ZRSNZINYAWTAHE-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
CD3OC6H4CHO |
| Exact Mass |
139.07100 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])OC1=CC=C(C=C1)C=O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
123-11-5 |
| Unlabeled Synonyms |
p-Methoxybenzaldehyde; Anisaldehyde |
Please kindly note that our products and services are for research use only.
