4-Hydroxybenzoic acid-isobutyl ester D4 (Ring D4)
| Catalog Number |
ACM1219805330-1 |
| CAS |
1219805-33-0 |
| Synonyms |
4-Hydroxybenzoic acid-isobutyl ester D4 (ring D4); 4-Hydroxybenzoic acid-isobutyl ester D4 (Ring D4) |
| IUPAC Name |
2-methylpropyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| Molecular Weight |
198.25 |
| Molecular Formula |
C11D4H10O3 |
| InChI |
InChI=1S/C11H14O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h3-6,8,12H,7H2,1-2H3/i3D,4D,5D,6D |
| InChI Key |
XPJVKCRENWUEJH-LNFUJOGGSA-N |
| Accurate Mass |
198.1194 |
| Format |
Neat |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1C(=O)OCC(C)C)[2H])[2H])O)[2H] |
| Shipping Temperature |
>20 °C |
| Storage Conditions |
>20 °C |
Please kindly note that our products and services are for research use only.
