| Catalog Number |
ACM221093385-1 |
| CAS |
221093-38-5 |
| Structure |
 |
| Synonyms |
(17b)-Estra-1,3,5(10)-triene-3,4,17-triol-d5 |
| IUPAC Name |
(8R,9S,13S,14S,17S)-16,16,17-trideuterio-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3,4,17-triol |
| Molecular Weight |
293.42 |
| Molecular Formula |
C18H19D5O3 |
| InChI |
InChI=1S/C18H24O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,16,19-21H,2-3,5,7-9H2,1H3/t11-,12-,14+,16+,18+/m1/s1/i7D2,16D |
| InChI Key |
QOZFCKXEVSGWGS-WPSCEDOOSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@]1([C@]2(CC[C@H]3[C@H]([C@@H]2CC1([2H])[2H])CCC4=C3C=CC(=C4O)O)C)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store refrigerated |
| Unlabeled CAS |
5976-61-4 |
| Unlabeled Synonyms |
1,3,5(10)-Estratrien-3,4,17β-triol |
