| Catalog Number |
ACM68165571 |
| CAS |
68165-57-1 |
| Structure |
 |
| Synonyms |
4-CHOLESTEN-3-ONE-4-13C |
| Molecular Weight |
385.65 |
| Molecular Formula |
13CC26H44O |
| InChI |
InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h17-19,22-25H,6-16H2,1-5H3/t19-,22+,23-,24+,25+,26+,27-/m1/s1/i17+1 |
| InChI Key |
NYOXRYYXRWJDKP-HLMQNULZSA-N |
| Purity |
99 atom % 13C |
| Isomeric SMILES |
C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=[13CH]C(=O)CC[C@]34C)C |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
601-57-0 |
| Unlabeled Synonyms |
(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
