| Catalog Number |
ACM1219799300 |
| CAS |
1219799-30-0 |
| IUPAC Name |
deuterio 1,1,2,2,3,3-hexadeuterio-3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propane-1-sulfonate |
| Molecular Weight |
224.35 |
| Molecular Formula |
C7H15NO4S |
| InChI |
InChI=1S/C7H15NO4S/c9-13(10,11)7-1-2-8-3-5-12-6-4-8/h1-7H2,(H,9,10,11)/i1D2,2D2,3D2,4D2,5D2,6D2,7D2/hD |
| InChI Key |
DVLFYONBTKHTER-OTUIAQFOSA-N |
| Purity |
97-98 atom % D |
| Exact Mass |
224.16633032 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C(OC(C(N1C([2H])([2H])C([2H])([2H])C([2H])([2H])S(=O)(=O)O[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
224.16633032 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
1132-61-2 |
| Unlabeled Synonyms |
4-Morpholinepropane sulfonic acid; MOPS |
