3',4'-Dimethoxyaceto-d3-phenone
| Catalog Number |
ACM350818541-1 |
| CAS |
350818-54-1 |
| Structure |
 |
| Synonyms |
1-(3,4-Dimethoxyphenyl)(2H3)ethanone |
| IUPAC Name |
2,2,2-trideuterio-1-(3,4-dimethoxyphenyl)ethanone |
| Molecular Weight |
183.22 |
| Molecular Formula |
C10H9D3O3 |
| InChI |
InChI=1S/C10H12O3/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h4-6H,1-3H3/i1D3 |
| InChI Key |
IQZLUWLMQNGTIW-FIBGUPNXSA-N |
| Chemical Formula |
(CH3O)2C6H3COCD3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)C1=CC(=C(C=C1)OC)OC |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
1131-62-0 |
| Unlabeled Synonyms |
4-Acetylveratrole |
Please kindly note that our products and services are for research use only.
