| Catalog Number |
ACM88247692 |
| CAS |
88247-69-2 |
| Structure |
 |
| Synonyms |
25-Hydroxycholesterol-D6 |
| IUPAC Name |
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-7,7,7-trideuterio-6-hydroxy-6-(trideuteriomethyl)heptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Weight |
408.70 |
| Molecular Formula |
C27H40D6O2 |
| InChI |
InChI=1S/C27H46O2/c1-18(7-6-14-25(2,3)29)22-10-11-23-21-9-8-19-17-20(28)12-15-26(19,4)24(21)13-16-27(22,23)5/h8,18,20-24,28-29H,6-7,9-17H2,1-5H3/t18-,20+,21+,22-,23+,24+,26+,27-/m1/s1/i2D3,3D3 |
| InChI Key |
INBGSXNNRGWLJU-KHKDDIDZSA-N |
| Purity |
99 atom % D |
| Exact Mass |
408.38700 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)(C([2H])([2H])[2H])O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
2140-46-7 |
| Unlabeled Synonyms |
5-Cholesten-3β,25-diol |
