| Catalog Number |
ACM144154789 |
| CAS |
144154-78-9 |
| Structure |
 |
| Synonyms |
24(RS)-Hydroxycholesterol-D7 |
| IUPAC Name |
(8S,9S,10R,13R,14S,17R)-1,1,2,2,3,4,4-heptadeuterio-17-[(2R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-3-ol |
| Molecular Weight |
409.70 |
| Molecular Formula |
C27H39D7O2 |
| InChI |
InChI=1S/C27H46O2/c1-17(2)25(29)11-6-18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25,28-29H,6,8-16H2,1-5H3/t18-,20?,21+,22-,23+,24+,25?,26+,27-/m1/s1/i12D2,14D2,16D2,20D |
| InChI Key |
IOWMKBFJCNLRTC-LAIQKCHSSA-N |
| Purity |
99 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C2=CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@]2(C(C(C1([2H])O)([2H])[2H])([2H])[2H])C)C)[C@H](C)CCC(C(C)C)O)[2H] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| CAS (Unlabeled) |
30271-38-6 |
| Synonyms (Unlabeled) |
5-Cholesten-3β-24(RS)-diol |
