| Catalog Number |
ACM1219805432 |
| CAS |
1219805-43-2 |
| Synonyms |
D3-2-Phenylethyl acetate |
| IUPAC Name |
2-phenylethyl 2,2,2-trideuterioacetate |
| Molecular Weight |
167.22 |
| Molecular Formula |
C10H9D3O2 |
| InChI |
InChI=1S/C10H12O2/c1-9(11)12-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3/i1D3 |
| InChI Key |
MDHYEMXUFSJLGV-FIBGUPNXSA-N |
| Purity |
99 atom % D |
| Chemical Formula |
C6H5CH2CH2OCOCD3 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)OCCC1=CC=CC=C1 |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
103-45-7 |
| Unlabeled Synonyms |
Acetic acid 2-phenylethylester |
