2-Phenylethan-1,1,2,2-d4-ol
| Catalog Number |
ACM107473336 |
| CAS |
107473-33-6 |
| Structure |
 |
| Synonyms |
D4-Phenylethanol |
| IUPAC Name |
1,1,2,2-tetradeuterio-2-phenylethanol |
| Molecular Weight |
126.19 |
| Molecular Formula |
C8H6D4O |
| InChI |
InChI=1S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i6D2,7D2 |
| InChI Key |
WRMNZCZEMHIOCP-KXGHAPEVSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
C6H5CD2CD2OH |
| Isomeric SMILES |
[2H]C([2H])(C1=CC=CC=C1)C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
60-12-8 |
| Unlabeled Synonyms |
2-(Hydroxyethyl)benzene |
Please kindly note that our products and services are for research use only.
