| Catalog Number |
ACM35845637 |
| CAS |
35845-63-7 |
| Structure |
 |
| Synonyms |
Benzeneethanol-D5 |
| IUPAC Name |
2-(2,3,4,5,6-pentadeuteriophenyl)ethanol |
| Molecular Weight |
127.20 |
| Molecular Formula |
C8H5D5O |
| Canonical SMILES |
C1=CC=C(C=C1)CCO |
| InChI |
InChI=1S/C8H10O/c9-7-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i1D,2D,3D,4D,5D |
| InChI Key |
WRMNZCZEMHIOCP-RALIUCGRSA-N |
| Boiling Point |
218.199ºC at 760 mmHg |
| Flash Point |
98.432ºC |
| Purity |
98 atom % D |
| Density |
1.062 g/cm³ |
| Appearance |
Clear yellow oil |
| Chemical Formula |
C6D5CH2CH2OH |
| Exact Mass |
127.10500 |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])CCO)[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
60-12-8 |
| Unlabeled Synonyms |
2-(Hydroxyethyl)benzene |
